CAS 436095-79-3

3-[(Cyclopentylamino)sulfonyl]-4-methylbenzoic acid

Description:

3-[(Cyclopentylamino)sulfonyl]-4-methylbenzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety substituted with a sulfonamide group and a cyclopentylamino group. This compound features a cyclopentyl ring, which contributes to its hydrophobic characteristics, and the sulfonamide functional group, which can enhance its solubility in polar solvents. The presence of the methyl group on the benzene ring influences its electronic properties and steric hindrance. This compound may exhibit biological activity, potentially acting as an inhibitor or modulator in various biochemical pathways, making it of interest in pharmaceutical research. Its molecular interactions can be influenced by the functional groups present, which may affect its binding affinity to biological targets. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-[(Cyclopentylamino)sulfonyl]-4-methylbenzoic acid represents a class of compounds that may have significant applications in medicinal chemistry and drug development.

Formula: C₁₃H₁₇NO₄S

InChI: InChI=1S/C13H17NO4S/c1-9-6-7-10(13(15)16)8-12(9)19(17,18)14-11-4-2-3-5-11/h6-8,11,14H,2-5H2,1H3,(H,15,16)

InChI key: InChIKey=QHWAFWGVWZNRSU-UHFFFAOYSA-N

SMILES: S(NC1CCCC1)(=O)(=O)C2=CC(C(O)=O)=CC=C2C

Synonyms:

• 3-Cyclopentylsulfamoyl-4-methyl-benzoic acid
• 3-[(Cyclopentylamino)sulfonyl]-4-methylbenzoic acid
• Benzoic acid, 3-[(cyclopentylamino)sulfonyl]-4-methyl-

3-(Cyclopentylsulfamoyl)-4-methylbenzoic acid

CAS: 436095-79-3

Versatile small molecule scaffold

Formula: C₁₃H₁₇NO₄S

Purity: Min. 95%

Molecular weight: 283.35 g/mol

Ref: 3D-LSA09579