CAS 436096-87-6
:N-cyclohexyl-2-(3-formyl-2-methyl-1H-indol-1-yl)acetamide
Description:
N-cyclohexyl-2-(3-formyl-2-methyl-1H-indol-1-yl)acetamide, with the CAS number 436096-87-6, is a synthetic organic compound characterized by its complex structure, which includes an indole moiety and an acetamide functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the cyclohexyl group may contribute to its lipophilicity, influencing its interaction with biological targets. The indole structure is known for its role in various biological activities, including anti-inflammatory and anticancer properties. Additionally, the aldehyde functional group (formyl) can participate in further chemical reactions, such as condensation or reduction, allowing for the synthesis of derivatives. Overall, N-cyclohexyl-2-(3-formyl-2-methyl-1H-indol-1-yl)acetamide represents a compound with potential applications in drug development and research, particularly in the exploration of indole-based pharmacophores.
Formula:C18H22N2O2
InChI:InChI=1/C18H22N2O2/c1-13-16(12-21)15-9-5-6-10-17(15)20(13)11-18(22)19-14-7-3-2-4-8-14/h5-6,9-10,12,14H,2-4,7-8,11H2,1H3,(H,19,22)
Synonyms:- 1H-Indole-1-acetamide, N-cyclohexyl-3-formyl-2-methyl-
- N-Cyclohexyl-2-(3-formyl-2-methyl-1H-indol-1-yl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.