CAS 436099-08-0

diethyl [1-oxido-2-(2-phenylethyl)-3,4-dihydro-2H-pyrrol-2-yl]phosphonate

Description:

Diethyl [1-oxido-2-(2-phenylethyl)-3,4-dihydro-2H-pyrrol-2-yl]phosphonate is a chemical compound characterized by its phosphonate functional group, which is known for its applications in medicinal chemistry and as a potential bioactive agent. This compound features a diethyl ester moiety, contributing to its solubility and reactivity. The presence of a pyrrolidine ring indicates a cyclic structure that may influence its biological activity and stability. The phenylethyl substituent suggests potential interactions with biological targets, enhancing its pharmacological profile. Additionally, the oxido group indicates the presence of an oxygen atom bonded to the nitrogen in the pyrrolidine ring, which may affect the compound's electronic properties and reactivity. Overall, this compound's unique structure may confer specific characteristics such as lipophilicity, potential enzyme inhibition, or receptor binding, making it of interest in various fields, including drug development and agricultural chemistry. However, detailed studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₆H₂₄NO₄P

InChI: InChI=1/C16H24NO4P/c1-3-20-22(19,21-4-2)16(12-8-14-17(16)18)13-11-15-9-6-5-7-10-15/h5-7,9-10,14H,3-4,8,11-13H2,1-2H3

SMILES: CCOP(=O)(C1(CCC=N1=O)CCc1ccccc1)OCC

2-(Diethoxyphosphoryl)-2-phenethyl-3,4-dihydro-2H-pyrrole 1-Oxide

Controlled Product

CAS: 436099-08-0

Applications A spin trap useful as a probe for free radical formation during myocardial ischemia/reperfusion injury. An analogue of DMPO.
References Xu, Y-K., et al.: J. Org. Chem., 67, 7624 (2992)

Formula: C₁₆H₂₄NO₄P

Color and Shape: Neat

Molecular weight: 325.34

Ref: TR-D442070