CAS 436099-69-3
:N-(2-cyclohex-1-en-1-ylethyl)-4-hydroxybutan-1-aminium
Description:
N-(2-cyclohex-1-en-1-ylethyl)-4-hydroxybutan-1-aminium, with the CAS number 436099-69-3, is a quaternary ammonium compound characterized by its unique structural features. This substance contains a cyclohexene moiety, which contributes to its potential reactivity and steric properties. The presence of a hydroxy group at the 4-position of the butan-1-aminium chain enhances its solubility in polar solvents and may influence its biological activity. As a quaternary ammonium compound, it carries a positive charge, which can affect its interaction with biological membranes and other charged species. This compound may exhibit surfactant properties, making it useful in various applications, including pharmaceuticals, cosmetics, and as a potential antimicrobial agent. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, N-(2-cyclohex-1-en-1-ylethyl)-4-hydroxybutan-1-aminium represents a class of compounds with diverse applications due to their unique chemical structure and properties.
Formula:C12H24NO
InChI:InChI=1/C12H23NO/c14-11-5-4-9-13-10-8-12-6-2-1-3-7-12/h6,13-14H,1-5,7-11H2/p+1
InChI key:InChIKey=IBHJLRZIELQVTB-UHFFFAOYSA-N
SMILES:C(CNCCCCO)C=1CCCCC1.S(=O)(=O)(O)O
Synonyms:- 1-Butanol, 4-[[2-(1-cyclohexen-1-yl)ethyl]amino]-, sulfate (1:1)
- 1-Butanol, 4-[[2-(1-cyclohexen-1-yl)ethyl]amino]-, sulfate (1:1) (salt)
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
