CAS 436099-82-0

1-[(1R)-cyclohex-3-en-1-ylmethyl]piperazinediium

Description:

1-[(1R)-cyclohex-3-en-1-ylmethyl]piperazinediium, identified by its CAS number 436099-82-0, is a chemical compound that features a piperazine core substituted with a cyclohexene moiety. This compound is characterized by its di-cationic nature, which arises from the presence of two positive charges on the piperazine nitrogen atoms. The cyclohexene ring contributes to its structural complexity and may influence its reactivity and interaction with biological systems. Typically, such compounds can exhibit interesting pharmacological properties, potentially acting as ligands or modulators in various biochemical pathways. The presence of the cyclohexene group may also impart unique steric and electronic properties, affecting solubility and stability in different environments. Additionally, the stereochemistry indicated by the (1R) configuration suggests specific spatial arrangements that could be crucial for its biological activity. Overall, this compound's unique structure positions it as a candidate for further research in medicinal chemistry and related fields.

Formula: C₁₁H₂₂N₂

InChI: InChI=1/C11H20N2/c1-2-4-11(5-3-1)10-13-8-6-12-7-9-13/h1-2,11-12H,3-10H2/p+2/t11-/m0/s1

1-Cyclohex-3-enylmethyl-piperazine trifluoroacetate

CAS: 436099-82-0

Formula: C₁₃H₂₁F₃N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 294.318

Ref: 10-F029465