CAS 4361-29-9
:Cyclohexanepropanamide
Description:
Cyclohexanepropanamide, with the CAS number 4361-29-9, is an organic compound characterized by its amide functional group attached to a cyclohexane ring and a propyl chain. This compound typically exhibits a colorless to pale yellow appearance and is known for its relatively low solubility in water, while being more soluble in organic solvents. The presence of the cyclohexane ring contributes to its hydrophobic nature, while the amide group can engage in hydrogen bonding, influencing its physical properties such as boiling and melting points. Cyclohexanepropanamide may be utilized in various chemical syntheses and can serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its stability under standard conditions makes it a suitable candidate for further chemical reactions. However, like many organic compounds, it should be handled with care, considering potential health and environmental impacts. Proper safety measures should be observed when working with this substance in laboratory settings.
Formula:C9H17NO
InChI:InChI=1S/C9H17NO/c10-9(11)7-6-8-4-2-1-3-5-8/h8H,1-7H2,(H2,10,11)
InChI key:InChIKey=FMNWPBFQLPJWAM-UHFFFAOYSA-N
SMILES:C(CC(N)=O)C1CCCCC1
Synonyms:- Cyclohexanepropanamide
- 3-Cyclohexylpropanamide
- Cyclohexanepropionamide
- 3-Cyclohexylpropionamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-Cyclohexylpropionamide
CAS:<p>3-Cyclohexylpropionamide is a reactivating agent that inhibits the growth of cancer cells by binding to their receptors. 3-Cyclohexylpropionamide has been shown to reactivate tumor cells that have become resistant to certain drugs, such as phenylacetate. This drug also has inhibitory effects on the growth of tumor cell lines and in animal tests has shown efficacy against drug-resistant breast cancer and colon cancer models. 3-Cyclohexylpropionamide binds to the protein receptor at a site near the active site, which prevents it from activating the catalytic site. This binding prevents the formation of an enzyme-drug complex with the enzyme that is required for cell division, inhibiting protein synthesis and cell division.</p>Formula:C9H17NOPurity:Min. 95%Molecular weight:155.24 g/mol

