CAS 4361-93-7
:8H-1,3-Dioxolo[4,5-h][1]benzopyran-8-one
Description:
8H-1,3-Dioxolo[4,5-h][1]benzopyran-8-one, also known as coumarin, is a chemical compound characterized by its fused dioxole and benzopyran structures. It typically appears as a white to pale yellow crystalline solid with a sweet, pleasant odor reminiscent of freshly cut hay. This compound is soluble in organic solvents such as ethanol and ether but has limited solubility in water. It exhibits a range of biological activities, including anticoagulant, anti-inflammatory, and antimicrobial properties, making it of interest in pharmaceuticals and natural product chemistry. The compound's structure allows for various chemical modifications, leading to derivatives with enhanced biological activity. Additionally, it is used in the fragrance industry and as a flavoring agent in food products. However, it is important to note that coumarin can be toxic in high doses and is regulated in some countries due to potential health risks. Overall, 8H-1,3-Dioxolo[4,5-h][1]benzopyran-8-one is a versatile compound with significant applications across multiple fields.
Formula:C10H6O4
InChI:InChI=1S/C10H6O4/c11-8-4-2-6-1-3-7-10(9(6)14-8)13-5-12-7/h1-4H,5H2
InChI key:InChIKey=OZRUEXJYRHKIJC-UHFFFAOYSA-N
SMILES:O=C1OC=2C3=C(C=CC2C=C1)OCO3
Synonyms:- 7,8-Aiapin
- Cinnamic acid, 2-hydroxy-3,4-(methylenedioxy)-, δ-lactone
- 7,8-Methylenedioxycoumarin
- Daphnetin methylene ether
- 8H-1,3-Dioxolo[4,5-h][1]benzopyran-8-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
7,8-Methylenedioxycoumarin
CAS:<p>7,8-Methylenedioxycoumarin is a furanocoumarin compound, which is a type of organic molecule characterized by a coumarin core with an additional methylenedioxy group. It is primarily sourced from various plant species, particularly those in the Rutaceae family, where it is found in essential oils and extracts. The mode of action of 7,8-Methylenedioxycoumarin involves its natural fluorescing properties, making it highly valuable for use in various biochemical assays where visualization is key. Due to its unique chemical structure, it efficiently absorbs ultraviolet light and emits visible fluorescence, which is exploited in photochemistry and as a biological marker. Its applications extend to the fields of pharmaceuticals and environmental sciences, where it serves in drug development studies and as a tool for tracking organic pollutants in ecosystems. Researchers continue to explore its potential uses due to its distinctive chemical behavior and natural origin.</p>Formula:C10H6O4Purity:Min. 95%Molecular weight:190.15 g/mol
