CAS 4366-88-5

2-chloroquinoline-4-carbonitrile

Description:

2-Chloroquinoline-4-carbonitrile is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the second position and a cyano group at the fourth position of the quinoline ring significantly influences its chemical properties. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals, particularly in the development of antimicrobial and antitumor agents. It exhibits moderate solubility in organic solvents, while its reactivity can be attributed to the electron-withdrawing nature of the cyano group, which can participate in nucleophilic substitution reactions. Additionally, the chlorine substituent can affect the compound's electronic properties and reactivity, making it a useful intermediate in organic synthesis. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2-chloroquinoline-4-carbonitrile is a versatile compound with significant implications in medicinal chemistry and organic synthesis.

Formula: C₁₀H₅ClN₂

InChI: InChI=1/C10H5ClN2/c11-10-5-7(6-12)8-3-1-2-4-9(8)13-10/h1-5H

SMILES: c1ccc2c(c1)c(cc(Cl)n2)C#N

Synonyms:

• 2-Chloro-4-cyanoquinoline
• 4-Quinolinecarbonitrile, 2-Chloro-
• 2-Chloroquinoline-4-carbonitrile

2-Chloroquinoline-4-carbonitrile

CAS: 4366-88-5

Formula: C₁₀H₅ClN₂

Molecular weight: 188.6131

Ref: IN-DA00DG01

2-Chloroquinoline-4-carbonitrile

CAS: 4366-88-5

Formula: C₁₀H₅ClN₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 188.61

Ref: 10-F430755

2-Chloroquinoline-4-carbonitrile

CAS: 4366-88-5

2-Chloroquinoline-4-carbonitrile is a nucleophilic substitution reaction with methanol as the electrophile. The reaction has been studied kinetically, and the rate of reaction was found to depend on the substituents on the chloroquinoline ring. The substituent effect can be described by mesomeric interactions. The rate of reaction is also dependent on the concentration of methoxide ion, which is a reactant in this substitution reaction.
2-Chloroquinoline-4-carbonitrile is an organic compound that contains two methyl groups substituted onto the 2 and 4 positions of the quinoline ring. This organic compound reacts with methanol to form a substituted quinoline product and hydrogen gas.

Formula: C₁₀H₅ClN₂

Purity: Min. 95%

Molecular weight: 188.61 g/mol

Ref: 3D-EAA36688