CAS 436799-32-5
:5-bromo-2-(trifluoromethyl) pyridine
Description:
5-Bromo-2-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a bromine atom at the 5-position and a trifluoromethyl group at the 2-position. This compound typically exhibits a pale yellow to light brown appearance and is known for its aromatic properties due to the pyridine structure. The trifluoromethyl group contributes to its lipophilicity and can enhance the compound's reactivity in various chemical reactions, making it useful in synthetic organic chemistry and medicinal chemistry. The presence of bromine also introduces a site for nucleophilic substitution reactions. Additionally, this compound may exhibit biological activity, which can be explored in pharmaceutical applications. Its unique combination of functional groups allows for diverse applications, including in agrochemicals and as intermediates in the synthesis of more complex molecules. Proper handling and storage are essential due to potential toxicity and environmental considerations associated with halogenated compounds.
Formula:C6H3BrF3N
InChI:InChI=1/C6H3BrF3N/c7-4-1-2-5(11-3-4)6(8,9)10/h1-3H
SMILES:c1cc(C(F)(F)F)ncc1Br
Synonyms:- 2-Trifluoromethyl-5-bromopyridine
- 5-Bromo-2-trifluoromethylpyridine
- 5-bromo-2-trifluoromethyl pyridine
- 5-Bromo-2-(trifluoromethyl)pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Bromo-2-(trifluoromethyl)pyridine, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H3BrF3NPurity:97%Color and Shape:White, Powder or crystalline powderMolecular weight:226.005-Bromo-2-(trifluoromethyl)pyridine
CAS:Formula:C6H3BrF3NPurity:98%Color and Shape:SolidMolecular weight:225.99395-Bromo-2-(trifluoromethyl)pyridine
CAS:<p>5-Bromo-2-(trifluoromethyl)pyridine</p>Formula:C6H3BrF3NPurity:97%Color and Shape: white solidMolecular weight:225.99g/mol5-Bromo-2-(trifluoromethyl)pyridine
CAS:Formula:C6H3BrF3NPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:226.005-Bromo-2(trifluoromethyl)pyridine
CAS:Formula:C6H3BrF3NPurity:98%Color and Shape:Solid, Crystalline PowderMolecular weight:225.996




