CAS 436855-65-1

2-[(2-Furanylcarbonyl)amino]butanoic acid

Description:

2-[(2-Furanylcarbonyl)amino]butanoic acid, identified by its CAS number 436855-65-1, is an organic compound characterized by the presence of both an amino group and a carboxylic acid group, making it an amino acid derivative. The structure features a butanoic acid backbone with a furanylcarbonyl substituent, which contributes to its unique chemical properties. This compound is likely to exhibit polar characteristics due to the presence of the carboxylic acid and amino groups, allowing for potential solubility in polar solvents. Additionally, the furanyl group may impart aromatic properties, influencing its reactivity and interactions with other molecules. The compound could participate in various chemical reactions typical of amino acids, such as peptide bond formation, and may have applications in pharmaceuticals or biochemistry due to its structural features. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied.

Formula: C₉H₁₁NO₄

InChI: InChI=1S/C9H11NO4/c1-2-6(9(12)13)10-8(11)7-4-3-5-14-7/h3-6H,2H2,1H3,(H,10,11)(H,12,13)

InChI key: InChIKey=QSNGUCJSRYFXIZ-UHFFFAOYSA-N

SMILES: C(NC(C(O)=O)CC)(=O)C1=CC=CO1

Synonyms:

• 2-(Furan-2-ylformamido)butanoic acid
• 2-[(2-Furanylcarbonyl)amino]butanoic acid
• Butanoic acid, 2-[(2-furanylcarbonyl)amino]-

2-[(Furan-2-yl)formamido]butanoic acid

CAS: 436855-65-1

Versatile small molecule scaffold

Formula: C₉H₁₁NO₄

Purity: Min. 95%

Molecular weight: 197.2 g/mol

Ref: 3D-LSA85565