CAS 4371-20-4

[1,1′-Biphenyl]-2,2′,4,4′,6,6′-hexol

Description:

[1,1′-Biphenyl]-2,2′,4,4′,6,6′-hexol, also known by its CAS number 4371-20-4, is an organic compound characterized by its biphenyl structure with six hydroxyl (–OH) groups attached at specific positions on the biphenyl framework. This compound is a type of polyphenol and exhibits properties typical of phenolic compounds, such as antioxidant activity and potential applications in various fields, including pharmaceuticals and materials science. The presence of multiple hydroxyl groups enhances its solubility in polar solvents and contributes to its reactivity, making it a versatile building block in organic synthesis. Additionally, the compound may exhibit interesting thermal and chemical stability, which can be influenced by the arrangement of the hydroxyl groups. Its structural features allow for potential interactions with biological systems, making it a subject of interest in medicinal chemistry and biochemistry. Overall, [1,1′-Biphenyl]-2,2′,4,4′,6,6′-hexol is notable for its multifunctional properties and potential applications in various scientific domains.

Formula: C₁₂H₁₀O₆

InChI: InChI=1S/C12H10O6/c13-5-1-7(15)11(8(16)2-5)12-9(17)3-6(14)4-10(12)18/h1-4,13-18H

InChI key: InChIKey=PHDPNHJFOMABOA-UHFFFAOYSA-N

SMILES: OC1=C(C(O)=CC(O)=C1)C2=C(O)C=C(O)C=C2O

Synonyms:

• 2,2′,4,4′,6,6′-Biphenylhexol
• 2,2′-Biphloroglucinol
• [1,1′-Biphenyl]-2,2′,4,4′,6,6′-hexol
• Difucol

Strontium Ranelate Impurity 11

CAS: 4371-20-4

Formula: C₁₂H₁₀O₆

Molecular weight: 250.21

Ref: 4Z-R-1623

Difucol

CAS: 4371-20-4

Difucol is a chemical compound that is used as a reagent, speciality chemical or useful building block. It has been reported to be a versatile building block for the synthesis of complex compounds with various types of functional groups. Difucol has also been used as a research chemical in the synthesis of various pharmaceuticals. Difucol is soluble in water and alcohols, but insoluble in ethers and chloroform. The CAS number for difucol is 4371-20-4.

Formula: C₁₂H₁₀O₆

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 250.2 g/mol

Ref: 3D-FD182393

Strontium Ranelate Impurity 11

CAS: 4371-20-4

Formula: C₁₂H₁₀O₆

Molecular weight: 250.21

Ref: ST-EA-CP-S182009