CAS 4371-91-9: Silicic acid (H6Si2O7), hexamethyl ester

Description:Silicic acid (H6Si2O7), hexamethyl ester, with the CAS number 4371-91-9, is an organosilicon compound characterized by its structure, which features silicon atoms bonded to methyl groups. This compound is a derivative of silicic acid, where the hydroxyl groups are replaced by methyl groups, resulting in a more hydrophobic and less polar substance. Hexamethyl silicic acid is typically a colorless to pale yellow liquid with a low viscosity, making it suitable for various applications in organic synthesis and as a precursor in the production of siloxane polymers. Its chemical properties include stability under normal conditions, but it may undergo hydrolysis in the presence of moisture, reverting to silicic acid. The compound is generally considered to have low toxicity, but safety precautions should be taken when handling it, as with any chemical substance. Its unique properties make it valuable in fields such as materials science, coatings, and as a silicone additive in various formulations.

Formula:C₆H₁₈O₇Si₂

InChI:InChI=1S/C6H18O7Si2/c1-7-14(8-2,9-3)13-15(10-4,11-5)12-6/h1-6H3

InChI key:InChIKey=XOAJIYVOSJHEQB-UHFFFAOYSA-N

SMILES:O(C)[Si](OC)(OC)O[Si](OC)(OC)OC

Synonyms:
Bistrimethoxysiloxane
Hexamethoxydisiloxane
Hexamethyl disilicate
Methyl silicate ((MeO)6Si2O)
Silicic acid (H6Si2O7), hexamethyl ester
Trimethyl Trimethoxysilyl Orthosilicate
Methyl silicate ((MeO)6Si2O)
Silicic acid (H6Si2O7), hexamethyl ester
Hexamethyl diorthosilicate

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Hexamethoxydisiloxane REF: 3B-H1716CAS: 4371-91-9	>98.0%(GC)	127.00 €	Mon 07 Apr 25
hexamethyl diorthosilicate REF: IN-DA00DL4OCAS: 4371-91-9	95%	61.00 €~538.00 €	Mon 14 Apr 25
Hexamethoxydisiloxane REF: 54-OR1024737CAS: 4371-91-9	99%	57.00 €~2,014.00 €	Tue 15 Apr 25
Hexamethyl diorthosilicate REF: 3D-EAA37191CAS: 4371-91-9	Min. 95%	- - -	Discontinued product