CAS 4374-93-0
:Deoxyhumulone
Description:
Deoxyhumulone is a chemical compound classified as a bitter acid, primarily found in hops (Humulus lupulus), which are used in brewing beer. It is a derivative of humulone, one of the main bittering agents in hops. Deoxyhumulone is characterized by its unique structure, which includes a prenylated phloroglucinol backbone, contributing to its bitter flavor profile. This compound exhibits antimicrobial properties, making it of interest not only in the brewing industry but also in food preservation and potential therapeutic applications. Deoxyhumulone is typically present in lower concentrations compared to its parent compound, humulone, and its bitterness can vary depending on the specific hop variety and processing methods. Additionally, it may influence the aroma and flavor characteristics of beer, contributing to the overall sensory experience. As a natural compound, deoxyhumulone is generally recognized as safe when consumed in moderate amounts, although further research is ongoing to fully understand its biological activities and potential health benefits.
Formula:C21H30O4
InChI:InChI=1S/C21H30O4/c1-12(2)7-9-15-19(23)16(10-8-13(3)4)21(25)18(20(15)24)17(22)11-14(5)6/h7-8,14,23-25H,9-11H2,1-6H3
InChI key:InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-N
SMILES:C(CC(C)C)(=O)C1=C(O)C(CC=C(C)C)=C(O)C(CC=C(C)C)=C1O
Synonyms:- 1-Butanone, 3-methyl-1-[2,4,6-trihydroxy-3,5-bis(3-methyl-2-buten-1-yl)phenyl]-
- Butyrophenone, 2′,4′,6′-trihydroxy-3-methyl-3′,5′-bis(3-methyl-2-butenyl)-
- 1-Butanone, 3-methyl-1-[2,4,6-trihydroxy-3,5-bis(3-methyl-2-butenyl)phenyl]-
- Phlorobutyrophenone, 3-methyl-3′,5′-bis(3-methyl-2-butenyl)-
- 3-Methyl-1-[2,4,6-trihydroxy-3,5-bis(3-methyl-2-buten-1-yl)phenyl]-1-butanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
