CAS 4375-07-9
:(-)-Epipodophyllotoxin
Description:
(-)-Epipodophyllotoxin is a naturally occurring lignan derived from the roots of the plant Podophyllum peltatum, commonly known as the mayapple. It is characterized by its complex polycyclic structure, which includes a phenolic moiety and an ether linkage. This compound exhibits significant biological activity, particularly as an inhibitor of topoisomerase II, an enzyme crucial for DNA replication and repair. Due to its mechanism of action, (-)-epipodophyllotoxin has been studied for its potential use in cancer therapy, particularly in the treatment of various malignancies. The substance is typically found as a white to off-white crystalline powder and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO), but has limited solubility in water. Its pharmacological properties include cytotoxicity against certain tumor cell lines, making it a subject of interest in medicinal chemistry. However, its use is often limited by toxicity and side effects, necessitating further research to optimize its therapeutic potential while minimizing adverse effects.
Formula:C22H22O8
InChI:InChI=1S/C22H22O8/c1-25-16-4-10(5-17(26-2)21(16)27-3)18-11-6-14-15(30-9-29-14)7-12(11)20(23)13-8-28-22(24)19(13)18/h4-7,13,18-20,23H,8-9H2,1-3H3/t13-,18+,19-,20+/m0/s1
InChI key:InChIKey=YJGVMLPVUAXIQN-LGWHJFRWSA-N
SMILES:O=C1[C@@]2([C@@H](C=3C([C@@H](O)[C@]2(CO1)[H])=CC4=C(C3)OCO4)C5=CC(OC)=C(OC)C(OC)=C5)[H]
Synonyms:- (-)-Epipodophyllotoxin
- (5R,5aR,8aR,9S)-5,8,8a,9-Tetrahydro-9-hydroxy-5-(3,4,5-trimethoxyphenyl)furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one
- Furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one, 5,8,8a,9-tetrahydro-9-hydroxy-5-(3,4,5-trimethoxyphenyl)-, (5R,5aR,8aR,9S)-
- Furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one, 5,8,8a,9-tetrahydro-9-hydroxy-5-(3,4,5-trimethoxyphenyl)-, [5R-(5α,5aβ,8aα,9β)]-
- epi-Podophyllotoxin
- furo[3',4':6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one, 5,8,8a,9-tetrahydro-9-hydroxy-5-(3,4,5-trimethoxyphenyl)-, (5R,5aR,8aR,9S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(-)-Epipodophyllotoxin
CAS:(-)-Epipodophyllotoxin: anticancer, GI50=0.36μM (HeLa), 0.24μM (MCF-7), inhibits spindle assembly.Formula:C22H22O8Purity:99.72% - 99.97%Color and Shape:SolidMolecular weight:414.41Epi-podophyllotoxin
CAS:<p>Epi-podophyllotoxin is a lignan that is primarily derived from the rhizomes and roots of the plant species Podophyllum, commonly known as mayapple. This compound exhibits significant pharmacological activity, primarily due to its ability to disrupt the mitotic process. As an antimitotic agent, epi-podophyllotoxin exerts its effects by inhibiting microtubule assembly, which is crucial for cell division. This action leads to the arrest of the cell cycle in the metaphase, ultimately causing apoptosis in rapidly dividing cancer cells.</p>Formula:C22H22O8Purity:Min. 95%Molecular weight:414.41 g/mol





