CAS 4375-14-8
:Octahydro-1H-indole
Description:
Octahydro-1H-indole, with the CAS number 4375-14-8, is a bicyclic organic compound characterized by its saturated structure, which consists of a six-membered ring fused to a five-membered ring. This compound is a derivative of indole, where the double bonds have been fully saturated, resulting in a more stable and less reactive molecule compared to its unsaturated counterparts. Octahydro-1H-indole is typically colorless to pale yellow in appearance and is known for its distinctive odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. The compound is of interest in various fields, including pharmaceuticals and organic synthesis, as it can serve as a building block for more complex molecules. Its unique structure allows for potential applications in medicinal chemistry, particularly in the development of new drugs. Additionally, it may exhibit interesting biological activities, although specific properties can vary based on the context of its use.
Formula:C8H15N
InChI:InChI=1/C8H15N/c1-2-4-8-7(3-1)5-6-9-8/h7-9H,1-6H2
InChI key:InChIKey=PDELQDSYLBLPQO-UHFFFAOYSA-N
SMILES:C12C(NCC1)CCCC2
Synonyms:- Octahydroindole
- 1H-Indole, octahydro-
- Octahydro-1H-indole
- Indoline, hexahydro-
- 7-Azabicyclo[4.3.0]nonane
- octahydro-1H-indole, Mixture of diastereomers
- Perhydro-1H-indole
- Einecs 224-472-4
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Octahydro-1H-indole
CAS:Octahydro-1H-indolePurity:95%Color and Shape:SolidMolecular weight:125.21g/molOctahydro-1H-indole
CAS:<p>Octahydro-1H-indole is a chiral compound with two asymmetric carbon atoms. It can be synthesized from cyclohexane ring and intramolecular hydrogen. Octahydro-1H-indole has been shown to have inhibitory properties against enzymes, such as cholinesterase, which are responsible for the breakdown of acetylcholine in the body. It can also be used to treat bowel disease, lung damage, and congestive heart failure. Octahydro-1H-indole is industrially prepared by reacting allyl carbonate with indole in the presence of a catalyst to produce an intermediate that reacts with hydrochloric acid to produce octahydro-1H-indole.</p>Formula:C8H15NPurity:Min. 95%Molecular weight:125.21 g/mol

