CAS 437708-59-3

1-Cyanocyclohexanecarboxamide

Description:

1-Cyanocyclohexanecarboxamide, with the CAS number 437708-59-3, is an organic compound characterized by its unique structure, which includes a cyclohexane ring substituted with both a cyano group (-CN) and a carboxamide group (-C(=O)NH2). This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents due to the presence of the amide functional group, which can engage in hydrogen bonding. The cyano group contributes to the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions. The presence of the cyclohexane ring provides a degree of rigidity and influences the compound's overall steric and electronic properties. Additionally, 1-cyanocyclohexanecarboxamide may exhibit biological activity, making it of interest in pharmaceutical research. Its stability and reactivity can vary based on environmental conditions, such as temperature and pH. Overall, this compound represents a versatile structure in organic chemistry with potential applications in synthesis and medicinal chemistry.

Formula: C₈H₁₂N₂O

InChI: InChI=1S/C8H12N2O/c9-6-8(7(10)11)4-2-1-3-5-8/h1-5H2,(H2,10,11)

InChI key: InChIKey=ONDWZUYZRUJNHQ-UHFFFAOYSA-N

SMILES: C(N)(=O)C1(C#N)CCCCC1

Synonyms:

• 1-Cyanocyclohexane-1-carboxamide
• Cyclohexanecarboxamide, 1-cyano-
• 1-Cyanocyclohexanecarboxamide