CAS 437723-96-1
:(R)-Bupropion
Description:
(R)-Bupropion is a chiral compound primarily recognized as an antidepressant and smoking cessation aid. It is classified as an aminoketone and is structurally distinct from other antidepressants, as it primarily acts as a norepinephrine-dopamine reuptake inhibitor (NDRI). The (R) enantiomer is known for its pharmacological activity, while the (S) enantiomer is less active. This compound exhibits a moderate lipophilicity, allowing it to cross the blood-brain barrier effectively. Its mechanism of action involves the modulation of neurotransmitter levels, particularly norepinephrine and dopamine, which contributes to its therapeutic effects. (R)-Bupropion is also associated with a lower risk of sexual side effects compared to other antidepressants. Additionally, it has a favorable safety profile, although it may increase the risk of seizures in predisposed individuals. The substance is typically administered in oral form and is metabolized in the liver, with its metabolites contributing to its overall pharmacological effects. Overall, (R)-Bupropion is a significant agent in the treatment of depression and smoking cessation, with unique characteristics that differentiate it from other medications in its class.
Formula:C13H18ClNO
InChI:InChI=1S/C13H18ClNO/c1-9(15-13(2,3)4)12(16)10-6-5-7-11(14)8-10/h5-9,15H,1-4H3/t9-/m1/s1
InChI key:InChIKey=SNPPWIUOZRMYNY-SECBINFHSA-N
SMILES:C([C@H](NC(C)(C)C)C)(=O)C1=CC(Cl)=CC=C1
Synonyms:- (2R)-2-(tert-Butylamino)-1-(3-chlorophenyl)propan-1-one
- 1-Propanone, 1-(3-chlorophenyl)-2-[(1,1-dimethylethyl)amino]-, (2R)-
- (2R)-1-(3-Chlorophenyl)-2-[(1,1-dimethylethyl)amino]-1-propanone
- (R)-Bupropion
- R-Bupropion
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Bupropion (R)-Isomer
CAS:Controlled Product<p>Bupropion is a racemic mixture of two enantiomers. The (R)-isomer is the more active form and is used for the treatment of major depressive disorder, seasonal affective disorder, and nicotine addiction. Bupropion has been shown to inhibit monoamine oxidase type A in humans and other mammals. This inhibition may be responsible for its antidepressant effects. The drug also has an effect on the liver, which can lead to serious side effects such as seizures or death if not monitored carefully. Bupropion has a high affinity for α1-acid glycoprotein, which plays a role in drug interactions with other drugs that are metabolized by this protein.</p>Formula:C13H18ClNOPurity:Min. 95%Molecular weight:239.74 g/mol
