CAS 438049-64-0

6-[(2-Fluorophenyl)methoxy]-3-pyridinemethanol

Description:

6-[(2-Fluorophenyl)methoxy]-3-pyridinemethanol, identified by its CAS number 438049-64-0, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a methoxy group attached to a fluorophenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The fluorine atom in the 2-position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and biological activity. The hydroxyl group in the pyridine ring may contribute to hydrogen bonding capabilities, affecting its interactions in biological systems. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be assessed under various conditions to determine its suitability for further applications.

Formula: C₁₃H₁₂FNO₂

InChI: InChI=1S/C13H12FNO2/c14-12-4-2-1-3-11(12)9-17-13-6-5-10(8-16)7-15-13/h1-7,16H,8-9H2

InChI key: InChIKey=DOXVPIRIYIEGAA-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(CO)C=N1)C2=C(F)C=CC=C2

Synonyms:

• [6-[(2-Fluorophenyl)methoxy]pyridin-3-yl]methanol
• 3-Pyridinemethanol, 6-[(2-fluorophenyl)methoxy]-
• 6-[(2-Fluorophenyl)methoxy]-3-pyridinemethanol

{6-[(2-Fluorophenyl)methoxy]pyridin-3-yl}methanol

CAS: 438049-64-0

Versatile small molecule scaffold

Formula: C₁₃H₁₂FNO₂

Purity: Min. 95%

Molecular weight: 233.24 g/mol

Ref: 3D-NSA04964