CymitQuimica logo

CAS 438049-91-3

:

tert-butyl (3R,5R)-3,5-dimethylpiperazine-1-carboxylate

Description:
Tert-butyl (3R,5R)-3,5-dimethylpiperazine-1-carboxylate is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of tert-butyl and dimethyl groups contributes to its steric bulk and hydrophobic properties, influencing its solubility and reactivity. This compound features a carboxylate functional group, which can participate in various chemical reactions, including esterification and amidation. The specific stereochemistry indicated by the (3R,5R) configuration suggests that the compound has defined spatial arrangements, which can affect its biological activity and interactions with other molecules. Typically, such compounds are of interest in medicinal chemistry and drug development due to their potential pharmacological properties. The CAS number 438049-91-3 uniquely identifies this substance, facilitating its recognition in chemical databases and literature. Overall, the characteristics of this compound make it a subject of interest for further research in various chemical and pharmaceutical applications.
Formula:C11H22N2O2
InChI:InChI=1/C11H22N2O2/c1-8-6-13(7-9(2)12-8)10(14)15-11(3,4)5/h8-9,12H,6-7H2,1-5H3/t8-,9-/m1/s1
InChI key:NUZXPHIQZUYMOR-RKDXNWHRSA-N
SMILES:C[C@@H]1CN(C[C@@H](C)N1)C(=O)OC(C)(C)C
Found 5 products.