CAS 4381-13-9
:N-hydroxydicarbonimidic diamide
Description:
N-hydroxydicarbonimidic diamide, commonly known as urea, is a chemical compound characterized by its simple structure and significant role in various biological and industrial processes. It is a white crystalline solid that is highly soluble in water, making it an effective nitrogen source for plants and a key component in fertilizers. The compound features two amine groups and a hydroxyl group, contributing to its reactivity and ability to form hydrogen bonds. Urea is also known for its use in the synthesis of various organic compounds and as a denaturant in protein chemistry. In biological systems, it plays a crucial role in the urea cycle, facilitating the excretion of excess nitrogen. Additionally, N-hydroxydicarbonimidic diamide is utilized in the production of resins, plastics, and pharmaceuticals, highlighting its versatility in both natural and industrial applications. Its relatively low toxicity and biodegradability further enhance its appeal in environmental contexts.
Formula:C2H5N3O3
InChI:InChI=1/C2H5N3O3/c3-1(6)5(8)2(4)7/h8H,(H2,3,6)(H2,4,7)
SMILES:C(=N)(N(C(=N)O)O)O
Synonyms:- imidodicarbonic diamide, N-hydroxy-
- N-Hydroxydicarbonimidic diamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.


