CAS 4382-36-9
:(2R,3R)-2-(3,4-Dihydroxyphenyl)-2,3-dihydro-3,7-dihydroxy-4H-1-benzopyran-4-one
Description:
The chemical substance known as (2R,3R)-2-(3,4-Dihydroxyphenyl)-2,3-dihydro-3,7-dihydroxy-4H-1-benzopyran-4-one, with the CAS number 4382-36-9, is a flavonoid compound characterized by its complex polyphenolic structure. This compound features multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of the benzopyran moiety indicates that it belongs to the flavonoid class, which is known for various biological activities, including anti-inflammatory and anti-cancer effects. The stereochemistry denoted by (2R,3R) suggests specific spatial arrangements of atoms that can influence the compound's reactivity and interaction with biological targets. Its solubility and stability can vary depending on the solvent and environmental conditions, making it of interest in both pharmaceutical and nutritional contexts. Research into this compound may focus on its potential health benefits, mechanisms of action, and applications in food science or medicine.
Formula:C15H12O6
InChI:InChI=1S/C15H12O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,14-18,20H/t14-,15+/m0/s1
InChI key:InChIKey=FNUPUYFWZXZMIE-LSDHHAIUSA-N
SMILES:O[C@@H]1[C@H](OC=2C(C1=O)=CC=C(O)C2)C3=CC(O)=C(O)C=C3
Synonyms:- (2R,3R)-2-(3,4-Dihydroxyphenyl)-2,3-dihydro-3,7-dihydroxy-4H-1-benzopyran-4-one
- Flavanone, 3,3′,4′,7-tetrahydroxy-, (+)-
- (+)-Fustin
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-2,3-dihydro-3,7-dihydroxy-, (2R-trans)-
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-2,3-dihydro-3,7-dihydroxy-, (2R,3R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.