CAS 4382-53-0
:5-benzyloxyindole-3-acetic acid
Description:
5-Benzyloxyindole-3-acetic acid is a chemical compound that belongs to the class of indole derivatives, characterized by the presence of an indole ring system. This compound features a benzyloxy group at the 5-position and an acetic acid moiety at the 3-position of the indole structure. It is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water. The compound exhibits potential biological activity, particularly in the context of plant growth regulation and as a signaling molecule in various biological systems. Its structure allows for interactions with various biological targets, making it of interest in pharmacological research. The presence of both the benzyloxy and acetic acid functional groups contributes to its chemical reactivity and potential applications in medicinal chemistry. As with many indole derivatives, it may also exhibit fluorescence properties, which can be useful in various analytical techniques. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C17H15NO3
InChI:InChI=1/C17H15NO3/c19-17(20)8-13-10-18-16-7-6-14(9-15(13)16)21-11-12-4-2-1-3-5-12/h1-7,9-10,18H,8,11H2,(H,19,20)
SMILES:c1ccc(cc1)COc1ccc2c(c1)c(CC(=O)O)c[nH]2
Synonyms:- 1,2-Dipalmitoyl-sn-glycero-3-phosphatidic acid, sodium salt
- [5-(benzyloxy)-1H-indol-3-yl]acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Benzyloxyindole-3-acetic acid
CAS:Formula:C17H15NO3Purity:97%Color and Shape:SolidMolecular weight:281.30595-Benzyloxyindole-3-acetic acid
CAS:5-Benzyloxyindole-3-acetic acidFormula:C17H15NO3Color and Shape: lightly yellow crystalline powderMolecular weight:281.31g/mol5-Benzyloxyindole-3-acetic acid
CAS:<p>Please enquire for more information about 5-Benzyloxyindole-3-acetic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C17H15NO3Molecular weight:281.31 g/mol5-Benzyloxyindole-3-acetic acid
CAS:5-Benzyloxyindole-3-acetic acid is a synthetic chemical that is used as a plant growth regulator. It inhibits the uptake of other plant nutrients, such as nitrates and phosphate ions by roots, which leads to decreased plant growth. This compound also has an inhibitory effect on membranes and morphology. The inhibition of membrane transport can lead to cell death, which can be seen in the case of plants treated with this chemical. 5-Benzyloxyindole-3-acetic acid has been shown to affect the response pathway of plants at temperatures between c1-c3 degrees Celsius.Formula:C17H15NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:281.31 g/mol5-Benzyloxyindole-3-acetic Acid-13C3
CAS:Controlled ProductFormula:C3C14H15NO3Color and Shape:NeatMolecular weight:284.284




