CAS 438216-26-3

6-chloro-2-(5-methylfuran-2-yl)quinoline-4-carboxylic acid

Description:

6-Chloro-2-(5-methylfuran-2-yl)quinoline-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a quinoline core substituted with a chloro group and a furan moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the chloro substituent enhances its reactivity and potential for forming various derivatives. The furan ring, known for its aromaticity and electron-rich nature, can participate in electrophilic substitution reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its unique structural features suggest potential applications in drug design, especially in targeting specific biological pathways. Additionally, the compound's solubility and stability can be influenced by the functional groups present, which are critical for its behavior in biological systems and during synthesis. Overall, 6-chloro-2-(5-methylfuran-2-yl)quinoline-4-carboxylic acid represents a versatile scaffold for further chemical exploration and application.

Formula: C₁₅H₁₀ClNO₃

InChI: InChI=1/C15H10ClNO3/c1-8-2-5-14(20-8)13-7-11(15(18)19)10-6-9(16)3-4-12(10)17-13/h2-7H,1H3,(H,18,19)

SMILES: Cc1ccc(c2cc(c3cc(ccc3n2)Cl)C(=O)O)o1

Synonyms:

• 4-Quinolinecarboxylic Acid, 6-Chloro-2-(5-Methyl-2-Furanyl)-
• 6-Chloro-2-(5-methyl-2-furyl)quinoline-4-carboxylic acid

6-chloro-2-(5-methyl-2-furyl)quinoline-4-carboxylic acid

CAS: 438216-26-3

Purity: 95.0%

Molecular weight: 287.70001220703125

Ref: 10-F307460