CAS 438218-49-6: 5-[(2,3-Dichlorophenoxy)methyl]-2-furancarboxylic acid

Description: 5-[(2,3-Dichlorophenoxy)methyl]-2-furancarboxylic acid is a chemical compound characterized by its unique structure, which includes a furan ring and a dichlorophenoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to its functional groups. The presence of the dichlorophenoxy moiety suggests that it may have herbicidal or pesticidal properties, as many compounds with similar structures are known for their applications in agriculture. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents, which can influence its reactivity and interaction with biological systems. Additionally, the compound's molecular structure may allow for various chemical modifications, making it a candidate for further research in medicinal chemistry or agrochemical applications. As with many synthetic compounds, safety and environmental impact assessments are crucial for understanding its behavior in biological and ecological contexts.

Formula: C₁₂H₈Cl₂O₄

InChI: InChI=1S/C12H8Cl2O4/c13-8-2-1-3-9(11(8)14)17-6-7-4-5-10(18-7)12(15)16/h1-5H,6H2,(H,15,16)

InChI key: InChIKey=DGUXQMFHNWGUES-UHFFFAOYSA-N

SMILES: O=C(O)C=1OC(=CC1)COC=2C=CC=C(Cl)C2Cl

Synonyms:

• 5-[(2,3-Dichlorophenoxy)methyl]-2-furancarboxylic acid
• 2-Furancarboxylic acid, 5-[(2,3-dichlorophenoxy)methyl]-

5-[(2,3-Dichlorophenoxy)methyl]-2-furoic acid

CAS: 438218-49-6

Please enquire for more information about 5-[(2,3-Dichlorophenoxy)methyl]-2-furoic acid including the price, delivery time and more …

• Formula: C₁₂H₈Cl₂O₄
• Purity: Min. 95%
• Molecular weight: 287.09 g/mol