CAS 438218-65-6

2-amino-4-[4-(2-methylpropyl)phenyl]thiophene-3-carbonitrile

Description:

2-amino-4-[4-(2-methylpropyl)phenyl]thiophene-3-carbonitrile is a synthetic organic compound characterized by its complex structure, which includes a thiophene ring, an amino group, and a carbonitrile functional group. The presence of the thiophene moiety contributes to its potential applications in organic electronics and pharmaceuticals due to its ability to participate in π-π stacking interactions. The compound features a branched alkyl substituent (2-methylpropyl) on a phenyl ring, which can influence its solubility and lipophilicity, making it potentially useful in drug design. The amino group may serve as a site for further chemical modifications or interactions, enhancing its reactivity and biological activity. Additionally, the carbonitrile group can participate in various chemical reactions, including nucleophilic additions and cycloadditions. Overall, this compound's unique structural features suggest it may have interesting properties for applications in materials science and medicinal chemistry, although specific biological activities and physical properties would require further investigation.

Formula: C₁₅H₁₆N₂S

InChI: InChI=1/C15H16N2S/c1-10(2)7-11-3-5-12(6-4-11)14-9-18-15(17)13(14)8-16/h3-6,9-10H,7,17H2,1-2H3

SMILES: CC(C)Cc1ccc(cc1)c1csc(c1C#N)N

Synonyms:

• 2-Amino-4-(4-isobutylphenyl)thiophene-3-carbonitrile
• 3-Thiophenecarbonitrile, 2-Amino-4-[4-(2-Methylpropyl)Phenyl]-

2-Amino-4-(4-isobutylphenyl)thiophene-3-carbonitrile

CAS: 438218-65-6

Formula: C₁₅H₁₆N₂S

Molecular weight: 256.3659

Ref: IN-DA00DCYN

2-amino-4-(4-isobutylphenyl)thiophene-3-carbonitrile

CAS: 438218-65-6

Formula: C₁₅H₁₆N₂S

Purity: 95.0%

Molecular weight: 256.37

Ref: 10-F307647