CAS 438219-17-1

5-[(2,3-Dichlorophenoxy)methyl]-2-furancarboxaldehyde

Description:

5-[(2,3-Dichlorophenoxy)methyl]-2-furancarboxaldehyde is an organic compound characterized by its furan and aldehyde functional groups, which contribute to its reactivity and potential applications in various chemical processes. The presence of the 2,3-dichlorophenoxy group enhances its biological activity, making it of interest in pharmaceutical and agrochemical research. This compound typically exhibits moderate to high solubility in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the furan and chlorinated aromatic moieties. Its molecular structure suggests potential for electrophilic reactions, particularly due to the aldehyde group, which can participate in condensation reactions or serve as a reactive site for nucleophiles. Additionally, the dichlorophenoxy group may impart specific interactions with biological targets, influencing its efficacy in various applications. Safety data should be consulted for handling, as chlorinated compounds can pose environmental and health risks. Overall, this compound represents a unique structure with potential utility in synthetic chemistry and biological applications.

Formula: C₁₂H₈Cl₂O₃

InChI: InChI=1S/C12H8Cl2O3/c13-10-2-1-3-11(12(10)14)16-7-9-5-4-8(6-15)17-9/h1-6H,7H2

InChI key: InChIKey=RDQQXYCZCLYCQH-UHFFFAOYSA-N

SMILES: O(CC=1OC(C=O)=CC1)C2=C(Cl)C(Cl)=CC=C2

Synonyms:

• 5-[(2,3-Dichlorophenoxy)methyl]-2-furancarboxaldehyde
• 2-Furancarboxaldehyde, 5-[(2,3-dichlorophenoxy)methyl]-

5-(2,3-Dichlorophenoxymethyl)furan-2-carbaldehyde

CAS: 438219-17-1

Versatile small molecule scaffold

Formula: C₁₂H₈Cl₂O₃

Purity: Min. 95%

Molecular weight: 271.09 g/mol

Ref: 3D-NSA21917