CAS 438219-25-1

5-[(4-Nitrophenoxy)methyl]-2-furancarboxylic acid

Description:

5-[(4-Nitrophenoxy)methyl]-2-furancarboxylic acid is an organic compound characterized by its furan and carboxylic acid functional groups, along with a nitrophenoxy substituent. The presence of the furan ring contributes to its aromatic properties, while the carboxylic acid group imparts acidity and potential for hydrogen bonding. The nitrophenoxy moiety enhances the compound's electron-withdrawing characteristics, which can influence its reactivity and solubility in various solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and material science. Its structural features suggest potential applications in drug development or as a building block in organic synthesis. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, 5-[(4-Nitrophenoxy)methyl]-2-furancarboxylic acid represents a versatile chemical entity with potential utility in various chemical and pharmaceutical applications.

Formula: C₁₂H₉NO₆

InChI: InChI=1S/C12H9NO6/c14-12(15)11-6-5-10(19-11)7-18-9-3-1-8(2-4-9)13(16)17/h1-6H,7H2,(H,14,15)

InChI key: InChIKey=QBTFAJGZQGYZTH-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(N(=O)=O)C=C1)C=2OC(C(O)=O)=CC2

Synonyms:

• 5-[(4-Nitrophenoxy)methyl]-2-furancarboxylic acid
• 2-Furancarboxylic acid, 5-[(4-nitrophenoxy)methyl]-

5-[(4-Nitrophenoxy)methyl]furan-2-carboxylic acid

CAS: 438219-25-1

Versatile small molecule scaffold

Formula: C₁₂H₉NO₆

Purity: Min. 95%

Molecular weight: 263.2 g/mol

Ref: 3D-NSA21925