CAS 438220-46-3

5-[(4-Ethoxyphenoxy)methyl]-2-furancarboxaldehyde

Description:

5-[(4-Ethoxyphenoxy)methyl]-2-furancarboxaldehyde is an organic compound characterized by its furan and aldehyde functional groups, which contribute to its reactivity and potential applications in organic synthesis. The presence of the ethoxyphenoxy group enhances its solubility in organic solvents and may influence its biological activity. This compound typically exhibits a moderate to high boiling point due to its molecular weight and structure, and it is likely to be a pale yellow to light brown liquid or solid, depending on the specific conditions. Its reactivity is primarily attributed to the aldehyde functional group, which can participate in various chemical reactions, including condensation and oxidation. Additionally, the furan ring may engage in electrophilic aromatic substitution reactions. The compound's unique structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₄H₁₄O₄

InChI: InChI=1S/C14H14O4/c1-2-16-11-3-5-12(6-4-11)17-10-14-8-7-13(9-15)18-14/h3-9H,2,10H2,1H3

InChI key: InChIKey=SPRPGVQMLSAAEN-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(OCC)C=C1)C=2OC(C=O)=CC2

Synonyms:

• 5-[(4-Ethoxyphenoxy)methyl]-2-furancarboxaldehyde
• 2-Furancarboxaldehyde, 5-[(4-ethoxyphenoxy)methyl]-

5-(4-Ethoxyphenoxymethyl)furan-2-carbaldehyde

CAS: 438220-46-3

Versatile small molecule scaffold

Formula: C₁₄H₁₄O₄

Purity: Min. 95%

Molecular weight: 246.26 g/mol

Ref: 3D-NSA22046