CAS 438220-50-9
:5-[(4-Chloro-3-methylphenoxy)methyl]-2-furancarboxaldehyde
Description:
5-[(4-Chloro-3-methylphenoxy)methyl]-2-furancarboxaldehyde is an organic compound characterized by its unique structure, which includes a furan ring and an aldehyde functional group. The presence of the 4-chloro-3-methylphenoxy group contributes to its chemical properties, influencing its reactivity and potential applications. This compound typically exhibits moderate solubility in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the aromatic ring. The aldehyde functional group is reactive, making it susceptible to oxidation and condensation reactions. Additionally, the chlorinated aromatic moiety can impart specific biological activities, which may be of interest in pharmaceutical or agrochemical research. The compound's molecular structure suggests potential applications in the synthesis of more complex molecules or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, this compound represents a valuable entity in the field of organic chemistry with diverse potential applications.
Formula:C13H11ClO3
InChI:InChI=1S/C13H11ClO3/c1-9-6-10(4-5-13(9)14)16-8-12-3-2-11(7-15)17-12/h2-7H,8H2,1H3
InChI key:InChIKey=YFCVKBSWUILOON-UHFFFAOYSA-N
SMILES:C(OC1=CC(C)=C(Cl)C=C1)C=2OC(C=O)=CC2
Synonyms:- 2-Furancarboxaldehyde, 5-[(4-chloro-3-methylphenoxy)methyl]-
- 5-[(4-Chloro-3-methylphenoxy)methyl]-2-furancarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
