CAS 438221-05-7

Methyl 5-[[(1-formyl-2-naphthalenyl)oxy]methyl]-2-furancarboxylate

Description:

Methyl 5-[[(1-formyl-2-naphthalenyl)oxy]methyl]-2-furancarboxylate, identified by its CAS number 438221-05-7, is an organic compound characterized by its complex structure that includes a furan ring and a naphthalene moiety. This compound features a methoxycarbonyl group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the formyl group indicates that it can participate in various chemical reactions, such as condensation and nucleophilic addition. Its unique structure may impart specific properties, such as solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry and material science. The compound's stability, reactivity, and potential applications can be influenced by factors such as pH, temperature, and the presence of other reagents. Overall, Methyl 5-[[(1-formyl-2-naphthalenyl)oxy]methyl]-2-furancarboxylate represents a versatile building block for further chemical transformations and research in various fields.

Formula: C₁₈H₁₄O₅

InChI: InChI=1S/C18H14O5/c1-21-18(20)17-9-7-13(23-17)11-22-16-8-6-12-4-2-3-5-14(12)15(16)10-19/h2-10H,11H2,1H3

InChI key: InChIKey=GFDYAVWTSYEKEB-UHFFFAOYSA-N

SMILES: C(=O)C=1C2=C(C=CC1OCC=3OC(C(OC)=O)=CC3)C=CC=C2

Synonyms:

• Methyl 5-[[(1-formyl-2-naphthalenyl)oxy]methyl]-2-furancarboxylate
• 2-Furancarboxylic acid, 5-[[(1-formyl-2-naphthalenyl)oxy]methyl]-, methyl ester

5-(1-Formyl-naphthalen-2-yloxymethyl)-furan-2-carboxylic acid methyl ester

CAS: 438221-05-7

Versatile small molecule scaffold

Formula: C₁₈H₁₄O₅

Purity: Min. 95%

Molecular weight: 310.3 g/mol

Ref: 3D-NSA22105