CymitQuimica logo

CAS 438221-46-6

:

6-Methyl-2-[4-(1-methylethyl)phenyl]-4-quinolinecarboxylic acid hydrazide

Description:
6-Methyl-2-[4-(1-methylethyl)phenyl]-4-quinolinecarboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes a quinoline ring system and a hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and quinoline derivatives, such as potential biological activity and the ability to form hydrogen bonds due to the presence of the hydrazide moiety. It may display moderate solubility in organic solvents, depending on the specific substituents and their steric effects. The presence of the isopropyl group on the phenyl ring can influence its lipophilicity and reactivity. Additionally, compounds of this nature are often investigated for their pharmacological properties, including antimicrobial and anticancer activities, due to the biological relevance of quinoline derivatives. As with many organic compounds, the stability and reactivity can be influenced by environmental factors such as pH and temperature. Proper handling and safety measures should be observed when working with this substance in a laboratory setting.
Formula:C20H21N3O
InChI:InChI=1S/C20H21N3O/c1-12(2)14-5-7-15(8-6-14)19-11-17(20(24)23-21)16-10-13(3)4-9-18(16)22-19/h4-12H,21H2,1-3H3,(H,23,24)
InChI key:InChIKey=CPMJXSKPZIYARQ-UHFFFAOYSA-N
SMILES:C(NN)(=O)C=1C2=C(N=C(C1)C3=CC=C(C(C)C)C=C3)C=CC(C)=C2
Synonyms:
  • 6-Methyl-2-[4-(1-methylethyl)phenyl]-4-quinolinecarboxylic acid hydrazide
  • 4-Quinolinecarboxylic acid, 6-methyl-2-[4-(1-methylethyl)phenyl]-, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.