CAS 438227-35-1

4-(4-tert-butylphenyl)-5-methyl-1,3-thiazol-2-amine

Description:

4-(4-tert-butylphenyl)-5-methyl-1,3-thiazol-2-amine, identified by its CAS number 438227-35-1, is an organic compound characterized by its thiazole ring structure, which is a five-membered heterocyclic compound containing sulfur and nitrogen. This substance features a tert-butyl group and a methyl group, contributing to its hydrophobic properties and potentially influencing its solubility and reactivity. The presence of the amine functional group indicates that it can participate in hydrogen bonding, which may affect its interactions in biological systems or chemical reactions. The compound's structure suggests it may exhibit biological activity, making it of interest in pharmaceutical research. Its stability, melting point, and solubility characteristics would depend on the specific conditions and solvents used. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound's unique structural features position it as a candidate for various applications in organic synthesis and medicinal chemistry.

Formula: C₁₄H₁₈N₂S

InChI: InChI=1/C14H18N2S/c1-9-12(16-13(15)17-9)10-5-7-11(8-6-10)14(2,3)4/h5-8H,1-4H3,(H2,15,16)

SMILES: Cc1c(c2ccc(cc2)C(C)(C)C)[nH]c(=N)s1

Synonyms:

• 2-Thiazolamine, 4-[4-(1,1-dimethylethyl)phenyl]-5-methyl-
• 4-(4-tert-Butylphenyl)-5-methyl-1,3-thiazol-2-amine

4-(4-tert-Butyl-phenyl)-5-methyl-thiazol-2-ylamine

CAS: 438227-35-1

Formula: C₁₄H₁₈N₂S

Purity: 95.0%

Molecular weight: 246.37

Ref: 10-F015772