CAS 438230-35-4

4-ethyl-5-(2-methylfuran-3-yl)-4H-1,2,4-triazole-3-thiol

Description:

4-Ethyl-5-(2-methylfuran-3-yl)-4H-1,2,4-triazole-3-thiol is a chemical compound characterized by its unique triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features an ethyl group and a 2-methylfuran moiety, contributing to its potential biological activity and solubility properties. The presence of the thiol (-SH) group is significant, as it can participate in various chemical reactions, including nucleophilic substitutions and redox reactions, making it a valuable functional group in medicinal chemistry. The compound may exhibit properties such as antimicrobial, antifungal, or herbicidal activities, which are common in triazole derivatives. Its molecular structure suggests potential interactions with biological targets, making it of interest in pharmaceutical research. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the triazole ring and the furan group, which may affect its application in various chemical and biological contexts.

Formula: C₉H₁₁N₃OS

InChI: InChI=1/C9H11N3OS/c1-3-12-8(10-11-9(12)14)7-4-5-13-6(7)2/h4-5H,3H2,1-2H3,(H,11,14)

SMILES: CCn1c(c2ccoc2C)nnc1S

Synonyms:

• 4-Ethyl-5-(2-methyl-3-furyl)-4H-1,2,4-triazole-3-thiol
• 4H-1,2,4-triazole-3-thiol, 4-ethyl-5-(2-methyl-3-furanyl)-

4-ethyl-5-(2-methyl-3-furyl)-4H-1,2,4-triazole-3-thiol

CAS: 438230-35-4

Formula: C₉H₁₁N₃OS

Purity: 95.0%

Molecular weight: 209.27

Ref: 10-F307694