CAS 4383-05-5
:3-methoxysalicyl alcohol
Description:
3-Methoxysalicyl alcohol, with the CAS number 4383-05-5, is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH₃) and a hydroxyl group (-OH) attached to a salicylic acid framework. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its solubility in organic solvents, such as ethanol and ether, while exhibiting limited solubility in water due to its hydrophobic methoxy group. 3-Methoxysalicyl alcohol possesses various functional properties, including potential antioxidant and anti-inflammatory activities, making it of interest in pharmaceutical and cosmetic applications. Its structure allows for hydrogen bonding, which can influence its reactivity and interactions with other molecules. Additionally, it may be used as an intermediate in organic synthesis or as a building block for more complex chemical entities. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C8H10O3
InChI:InChI=1/C8H10O3/c1-11-7-4-2-3-6(5-9)8(7)10/h2-4,9-10H,5H2,1H3
InChI key:InChIKey=OSZHSESNQIMXMZ-UHFFFAOYSA-N
SMILES:COc1cccc(CO)c1O
Synonyms:- 2-(Hydroxymethyl)-6-methoxyphenol
- 2-Hydroxy-3-methoxy-hydroxymethyl benzene
- 2-Hydroxy-3-methoxybenzenemethanol
- 2-Hydroxy-3-methoxybenzyl alcohol
- Benzenemethanol, 2-hydroxy-3-methoxy-
- Benzyl alcohol, 2-hydroxy-3-methoxy-
- Ortho-vanillyl alcohol
- o-(Hydroxymethyl)guaiacol
- o-Vanillyl alcohol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Hydroxy-3-methoxybenzyl Alcohol
CAS:Formula:C8H10O3Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:154.172-(Hydroxymethyl)-6-methoxyphenol
CAS:Formula:C8H10O3Purity:95%Color and Shape:SolidMolecular weight:154.16322-Hydroxy-3-methoxybenzyl alcohol
CAS:2-Hydroxy-3-methoxybenzyl alcoholPurity:97%Molecular weight:154.16g/mol2-Hydroxy-3-methoxybenzyl alcohol
CAS:<p>2-Hydroxy-3-methoxybenzyl alcohol is a phenolic compound that belongs to the class of mandelonitrile. It is an envenomation agent that has been shown to have a molecular weight of 146, and is synthesized by reacting 2-hydroxy-4-methoxybenzaldehyde with formic acid. This drug also has been shown to have high binding affinity for the androgen receptor, which allows it to be used as an antihormone therapy. 2-Hydroxyl-3-methoxybenzyl alcohol binds to hormone receptors in cells and prevents them from binding with the hormones needed for transcription. The hydroxyl group on this molecule allows it to act as an acceptor for other molecules in reactions involving formylation and hydroxylation reactions.</p>Formula:C8H10O3Purity:Min. 95%Color and Shape:PowderMolecular weight:154.16 g/mol





