CAS 4385-62-0
:4-(2-Pyridyl)benzoic acid
Description:
4-(2-Pyridyl)benzoic acid, with the CAS number 4385-62-0, is an organic compound characterized by its aromatic structure, which consists of a benzoic acid moiety substituted with a pyridine ring at the para position. This compound typically appears as a white to off-white crystalline solid. It is soluble in polar organic solvents such as ethanol and dimethyl sulfoxide, but its solubility in water is limited. The presence of both the carboxylic acid and pyridine functional groups contributes to its potential as a ligand in coordination chemistry, allowing it to form complexes with various metal ions. Additionally, the compound may exhibit interesting biological activities, making it a subject of research in medicinal chemistry. Its melting point and other physical properties can vary based on purity and environmental conditions. Overall, 4-(2-Pyridyl)benzoic acid is a versatile compound with applications in organic synthesis, materials science, and potentially in pharmaceuticals.
Formula:C12H8NO2
InChI:InChI=1/C12H9NO2/c14-12(15)10-6-4-9(5-7-10)11-3-1-2-8-13-11/h1-8H,(H,14,15)/p-1
SMILES:c1ccnc(c1)c1ccc(cc1)C(=O)[O-]
Synonyms:- 4-(Pyridin-2-yl)benzoic acid
- Benzoic Acid, 4-(2-Pyridinyl)-
- 2-[(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide
- 4-Pyridin-2-Ylbenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
4-(2-Pyridyl)benzoic Acid
CAS:Formula:C12H9NO2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:199.214-(2-Pyridyl)benzoic acid
CAS:Formula:C12H9NO2Purity:97%Color and Shape:SolidMolecular weight:199.20544-(2-Pyridyl)benzoic acid
CAS:4-(2-Pyridyl)benzoic acidPurity:98%Color and Shape:SolidMolecular weight:199.21g/molAtazanavir Impurity 15 (Pyridinyl Benzoic Acid)
CAS:Formula:C12H9NO2Color and Shape:White To Off-White SolidMolecular weight:199.214-(2-Pyridinyl)benzoic Acid
CAS:Controlled ProductImpurity Atazanavir Impurity (Pyridinyl Benzoic Acid)
Applications Reactive metabolite of Atazanavir (A790051). Atazanavir Impurity (Pyridinyl Benzoic Acid)
References Li, F. et al. Drug Metab. Disp., 39, 294 (2011);Formula:C12H9NO2Color and Shape:NeatMolecular weight:199.214-Pyridin-2-ylbenzoic acid
CAS:Formula:C12H9NO2Purity:97%Color and Shape:SolidMolecular weight:199.2094-(Pyridin-2-yl)benzoic acid
CAS:4-(Pyridin-2-yl)benzoic acid is a useful organic compound for research related to life sciences. The catalog number is T65363 and the CAS number is 4385-62-0.Formula:C12H9NO2Color and Shape:SolidMolecular weight:199.209







