CAS 4385-91-5
:O-Methylhomoserine
Description:
O-Methylhomoserine, with the CAS number 4385-91-5, is an amino acid derivative characterized by the presence of a methyl group attached to the hydroxyl group of homoserine. This compound is typically classified as a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation. O-Methylhomoserine is soluble in water due to its polar functional groups, which facilitate hydrogen bonding. It plays a role in various biochemical pathways, particularly in the synthesis of certain amino acids and metabolites. The compound is often studied in the context of plant biochemistry and microbial metabolism, where it may serve as an intermediate in the biosynthesis of essential compounds. Its structural formula includes a hydroxyl group, a carboxylic acid group, and an amino group, contributing to its reactivity and interactions in biological systems. As with many amino acid derivatives, O-Methylhomoserine can participate in various chemical reactions, including esterification and amidation, making it of interest in synthetic organic chemistry and biochemistry.
Formula:C5H11NO3
InChI:InChI=1S/C5H11NO3/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)
InChI key:InChIKey=KFHRMMHGGBCRIV-UHFFFAOYSA-N
SMILES:C(C(O)=O)(CCOC)N
Synonyms:- 2-Amino-4-methoxybutanoic acid
- A 7572
- Butanoate, 2-Amino-4-Methoxy-, Calcium Salt (1:1)
- Butyric acid, 2-amino-4-methoxy-
- Butyric acid, 2-amino-4-methoxy- (8CI)
- Butyric acid, 2-amino-4-methoxy-, DL-
- DL-2-Amino-4-methoxybutanoic acid
- Homoserine, O-methyl-
- Methoxine
- Methoxinine
- Nsc 9325
- O-Methylhomoserine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methoxine
CAS:Methoxine is an oxygen analog of methionine.Formula:C5H11NO3Color and Shape:SolidMolecular weight:133.14572-Amino-4-methoxybutanoic acid
CAS:2-Amino-4-methoxybutanoic acid (2AMBA) is a diagnostic agent that belongs to the class of hydroxyl group containing antimicrobial agents. It has been shown to have conformational properties, which are the spatial arrangement of atoms in a molecule. 2AMBA is a small molecule with neutral pH and has been used as a substrate for peptide synthesis by the yeast Pichia pastoris. 2AMBA has also been shown to have antimicrobial activity against infectious diseases such as Escherichia coli and Pseudomonas aeruginosa, among others. This compound is synthesized by reacting malonic acid with an amine or amide. The reaction forms a cyclic peptide that contains a disulfide bond and fatty acid, which are important for its structure and function.
Formula:C5H11NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:133.15 g/mol2-amino-4-methoxybutanoic Acid
CAS:Controlled ProductFormula:C5H11NO3Color and Shape:NeatMolecular weight:133.146


