CAS 438531-30-7

4-[[(2,3-Dihydro-1H-inden-5-yl)oxy]methyl]benzoic acid hydrazide

Description:

4-[[(2,3-Dihydro-1H-inden-5-yl)oxy]methyl]benzoic acid hydrazide is a chemical compound characterized by its complex structure, which includes a hydrazide functional group attached to a benzoic acid moiety. The presence of the 2,3-dihydro-1H-inden-5-yl group contributes to its unique properties, potentially influencing its reactivity and biological activity. This compound may exhibit various characteristics such as solubility in organic solvents, depending on the specific functional groups and their interactions. The hydrazide group can participate in various chemical reactions, including hydrazone formation and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential for interactions with biological targets, making it of interest in drug discovery and development. Additionally, the compound's stability, melting point, and other physical properties would be influenced by its molecular interactions and the presence of functional groups. Overall, 4-[[(2,3-Dihydro-1H-inden-5-yl)oxy]methyl]benzoic acid hydrazide represents a compound with potential applications in various fields, including organic synthesis and medicinal chemistry.

Formula: C₁₇H₁₈N₂O₂

InChI: InChI=1S/C17H18N2O2/c18-19-17(20)14-6-4-12(5-7-14)11-21-16-9-8-13-2-1-3-15(13)10-16/h4-10H,1-3,11,18H2,(H,19,20)

InChI key: InChIKey=BDZPNMZNYLJNKG-UHFFFAOYSA-N

SMILES: O(CC1=CC=C(C(NN)=O)C=C1)C=2C=C3C(=CC2)CCC3

Synonyms:

• 4-[[(2,3-Dihydro-1H-inden-5-yl)oxy]methyl]benzoic acid hydrazide
• Benzoic acid, 4-[[(2,3-dihydro-1H-inden-5-yl)oxy]methyl]-, hydrazide

4-(Indan-5-yloxymethyl)-benzoic acid hydrazide

CAS: 438531-30-7

Versatile small molecule scaffold

Formula: C₁₇H₁₈N₂O₂

Purity: Min. 95%

Molecular weight: 282.34 g/mol

Ref: 3D-NSA53130