CAS 438565-33-4

[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methanol

Description:

[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methanol, with the CAS number 438565-33-4, is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. The presence of a 2-chlorophenyl group indicates that there is a chlorine substituent on a phenyl ring, contributing to the compound's potential biological activity and lipophilicity. The methanol functional group suggests that the compound can participate in hydrogen bonding, which may influence its solubility and reactivity. This compound may exhibit properties typical of oxazole derivatives, such as antimicrobial or anti-inflammatory activities, although specific biological activities would depend on further empirical studies. Its molecular structure allows for various interactions with biological targets, making it of interest in medicinal chemistry. As with many organic compounds, its stability, reactivity, and potential applications would be influenced by environmental conditions such as pH and temperature.

Formula: C₁₀H₈ClNO₂

InChI: InChI=1/C10H8ClNO2/c11-9-4-2-1-3-8(9)10-5-7(6-13)14-12-10/h1-5,13H,6H2

SMILES: c1ccc(c(c1)c1cc(CO)on1)Cl

[3-(2-Chlorophenyl)isoxazol-5-yl]methanol

CAS: 438565-33-4

Formula: C₁₀H₈ClNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 209.6290

Ref: IN-DA003I0K

3-(2-Chlorophenyl)-5-(hydroxymethyl)isoxazole

CAS: 438565-33-4

3-(2-Chlorophenyl)-5-(hydroxymethyl)isoxazole

Purity: ≥95%

Molecular weight: 209.63g/mol

Ref: 54-OR15395

[3-(2-Chlorophenyl)isoxazol-5-yl]methanol

CAS: 438565-33-4

Formula: C₁₀H₈ClNO₂

Purity: 95%

Molecular weight: 209.63

Ref: 10-F091814