CAS 4386-42-9

2-hydroxy-3-methoxy-5-methylbenzoic acid

Description:

2-Hydroxy-3-methoxy-5-methylbenzoic acid, also known as gentisic acid, is an aromatic compound characterized by a benzoic acid structure with specific functional groups. It features a hydroxyl group (-OH) and a methoxy group (-OCH3) attached to the benzene ring, along with a methyl group (-CH3) at the 5-position. This compound is typically a white to off-white crystalline solid, soluble in polar solvents like water and alcohol due to the presence of the hydroxyl group. It exhibits weak acidity, typical of carboxylic acids, and can participate in various chemical reactions, including esterification and oxidation. Gentisic acid is of interest in biochemical research and has potential applications in pharmaceuticals and as an antioxidant. Its molecular structure allows it to engage in hydrogen bonding, influencing its physical properties and reactivity. Additionally, it may have biological significance, as it can be involved in metabolic pathways and has been studied for its potential health benefits.

Formula: C₉H₁₀O₄

InChI: InChI=1/C9H10O4/c1-5-3-6(9(11)12)8(10)7(4-5)13-2/h3-4,10H,1-2H3,(H,11,12)

SMILES: Cc1cc(c(c(c1)OC)O)C(=O)O

2-Hydroxy-3-methoxy-5-methylbenzoic acid

CAS: 4386-42-9

Formula: C₉H₁₀O₄

Purity: 97%

Molecular weight: 182.1733

Ref: IN-DA00DBEN

2-Hydroxy-3-methoxy-5-methylbenzoic acid

CAS: 4386-42-9

2-Hydroxy-3-methoxy-5-methylbenzoic acid is a molecule that has been shown to be an effective antioxidant. It has been shown to have an activation energy of 36.8 kJ/mol and a high rate of reaction with peroxides. The kinetic parameters for 2-hydroxy-3-methoxy-5-methylbenzoic acid are not well understood, but it has been experimentally determined that the oxidation reactions are fast, irreversible, and exothermic. It can also be used as a model compound for lignin oxidation in the environment. The molecular structure is shown below:

Formula: C₉H₁₀O₄

Purity: Min. 95%

Molecular weight: 182.17 g/mol

Ref: 3D-EAA38642