
CAS 4386-79-2
:1,3-Dioxolane-4-methanaminium, N,N,N,2-tetramethyl-, iodide (1:1)
Description:
1,3-Dioxolane-4-methanaminium, N,N,N,2-tetramethyl-, iodide (1:1), with CAS number 4386-79-2, is a quaternary ammonium compound characterized by its dioxolane ring structure and a tetramethylated amine group. This compound typically exhibits properties associated with ionic substances, such as high solubility in polar solvents and the ability to conduct electricity in solution. The presence of the iodide ion contributes to its ionic character, enhancing its reactivity and potential applications in various chemical processes. It may serve as a surfactant or a phase transfer catalyst due to its amphiphilic nature, which allows it to interact with both organic and aqueous phases. Additionally, the dioxolane moiety can provide stability and influence the compound's reactivity, making it useful in organic synthesis and as a building block in the development of more complex molecules. Safety data should be consulted for handling and storage, as quaternary ammonium compounds can exhibit varying degrees of toxicity and environmental impact.
Formula:C8H18NO2·I
InChI:InChI=1S/C8H18NO2.HI/c1-7-10-6-8(11-7)5-9(2,3)4;/h7-8H,5-6H2,1-4H3;1H/q+1;/p-1
InChI key:InChIKey=XFHBFOSBGWDTRO-UHFFFAOYSA-M
SMILES:C([N+](C)(C)C)C1COC(C)O1.[I-]
Synonyms:- Trimethyl[(2-methyl-1,3-dioxolan-4-yl)methyl]ammonium iodide
- 1,3-Dioxolane-4-methanaminium, N,N,N,2-tetramethyl-, iodide
- 4-[(Dimethylamino)methyl]-2-methyl-1,3-dioxolane methiodide
- Ammonium, trimethyl[(2-methyl-1,3-dioxolan-4-yl)methyl]-, iodide
- 1,3-Dioxolane-4-methanaminium, N,N,N,2-tetramethyl-, iodide (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methamilane methiodide
CAS:<p>Methamilane methiodide is a Muscarinic agonist.</p>Formula:C8H18INO2Color and Shape:SolidMolecular weight:287.14
