CAS 4390-04-9: 2,2,4,4,6,8,8-Heptamethylnonane
Description:2,2,4,4,6,8,8-Heptamethylnonane, with the CAS number 4390-04-9, is a branched-chain alkane characterized by its complex structure featuring seven methyl groups attached to a nonane backbone. This compound is a colorless liquid at room temperature and is insoluble in water, reflecting its nonpolar nature. Its high degree of branching contributes to its relatively low boiling point compared to straight-chain alkanes of similar molecular weight. The presence of multiple methyl groups enhances its stability and reduces its reactivity, making it a suitable candidate for use as a reference compound in various chemical analyses. Additionally, 2,2,4,4,6,8,8-Heptamethylnonane is often utilized in studies related to hydrocarbon behavior, environmental chemistry, and as a standard in gas chromatography due to its well-defined properties. Its low volatility and high molecular weight also suggest potential applications in lubricants and other industrial formulations. Overall, this compound exemplifies the unique characteristics of branched hydrocarbons in organic chemistry.
Formula:C16H34
InChI:InChI=1S/C16H34/c1-13(10-14(2,3)4)11-16(8,9)12-15(5,6)7/h13H,10-12H2,1-9H3
InChI key:InChIKey=VCLJODPNBNEBKW-UHFFFAOYSA-N
SMILES:CC(CC(C)(C)C)CC(C)(C)CC(C)(C)C
- Synonyms:
- 2,2,4,4,6,8,8-Heptamethyl nonane
- 2,2,4,4,6,8,8-Heptamethylnonan
- 2,2,4,4,6,8,8-Heptametilnonano
- HMN
- Isocetane
- Nonane, 2,2,4,4,6,8,8-heptamethyl-
- Nsc 77129
