CAS 439094-67-4

6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde

Description:

6-(3-Methoxyphenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde is a heterocyclic compound characterized by its imidazole and thiazole rings, which contribute to its unique chemical properties. This compound features a methoxyphenyl group, enhancing its solubility and potential reactivity. The presence of the aldehyde functional group indicates that it can participate in various chemical reactions, such as condensation and oxidation. Its structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The compound may exhibit fluorescence properties due to its conjugated system, which can be useful in imaging applications. Additionally, its molecular framework allows for interactions with biological targets, potentially leading to therapeutic applications. Overall, this compound's unique structural features and functional groups make it a subject of interest for further research in both synthetic and medicinal chemistry.

Formula: C₁₃H₁₀N₂O₂S

InChI: InChI=1/C13H10N2O2S/c1-17-10-4-2-3-9(7-10)12-11(8-16)15-5-6-18-13(15)14-12/h2-8H,1H3

SMILES: COc1cccc(c1)c1c(C=O)n2ccsc2n1

Synonyms:

• Imidazo[2,1-b]thiazole-5-carboxaldehyde, 6-(3-methoxyphenyl)-

6-(3-Methoxy-phenyl)-imidazo[2,1-b]thiazole-5-carbaldehyde

CAS: 439094-67-4

Purity: 95+%

Color and Shape: Solid

Molecular weight: 258.29998779296875

Ref: 10-F020353