CAS 439106-87-3

2-(1H-pyrazol-4-yl)quinoline

Description:

2-(1H-pyrazol-4-yl)quinoline is an organic compound characterized by the presence of both a quinoline and a pyrazole moiety in its structure. This compound typically exhibits a fused bicyclic system, which contributes to its aromaticity and stability. The pyrazole ring, containing two adjacent nitrogen atoms, imparts unique electronic properties, making it a potential candidate for various chemical reactions and applications in medicinal chemistry. The quinoline portion enhances the compound's ability to interact with biological targets, often leading to interesting pharmacological activities. Additionally, 2-(1H-pyrazol-4-yl)quinoline may exhibit fluorescence properties, which can be useful in analytical chemistry and biological imaging. Its solubility characteristics can vary depending on the solvent, influencing its application in different chemical environments. Overall, this compound is of interest in research fields such as drug development, agrochemicals, and materials science due to its diverse chemical behavior and potential biological activities.

Formula: C₁₂H₉N₃

InChI: InChI=1/C12H9N3/c1-2-4-11-9(3-1)5-6-12(15-11)10-7-13-14-8-10/h1-8H,(H,13,14)

SMILES: c1ccc2c(c1)ccc(c1c[nH]nc1)n2

Synonyms:

• Quinoline, 2-(1H-pyrazol-4-yl)-
• 2-(1H-Pyrazol-4-yl)quinoline

2-(1H-Pyrazol-4-yl)quinoline

CAS: 439106-87-3

Purity: 99.0%

Color and Shape: Solid

Molecular weight: 195.22500610351562

Ref: 10-F016088

2-(1H-Pyrazol-4-yl)quinoline

CAS: 439106-87-3

Formula: C₁₂H₉N₃

Color and Shape: Solid

Molecular weight: 195.2200

Ref: IN-DA00DCM1

2-(1H-Pyrazol-4-yl)quinoline

CAS: 439106-87-3

2-(1H-Pyrazol-4-yl)quinoline

Formula: C₁₂H₉N₃

Purity: 95%

Color and Shape: pale brown solid

Molecular weight: 195.22g/mol

Ref: 54-OR1033