CAS 439110-83-5
:α-Methyl-4-(1H-pyrrol-1-yl)benzenemethanol
Description:
α-Methyl-4-(1H-pyrrol-1-yl)benzenemethanol, with the CAS number 439110-83-5, is an organic compound characterized by its complex structure that includes a benzene ring substituted with a pyrrole group and a hydroxymethyl group. This compound features a methyl group at the alpha position relative to the hydroxymethyl group, which influences its chemical reactivity and physical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxyl group. The pyrrole moiety contributes to its potential biological activity, as compounds containing nitrogen heterocycles often interact with biological systems. The presence of both aromatic and aliphatic components suggests that it may participate in various chemical reactions, including electrophilic aromatic substitution and hydrogen bonding. Additionally, its unique structure may lend itself to applications in pharmaceuticals or materials science, although specific applications would depend on further research into its properties and interactions.
Formula:C12H13NO
InChI:InChI=1S/C12H13NO/c1-10(14)11-4-6-12(7-5-11)13-8-2-3-9-13/h2-10,14H,1H3
InChI key:InChIKey=IADAUMAMSILNIE-UHFFFAOYSA-N
SMILES:C(C)(O)C1=CC=C(C=C1)N2C=CC=C2
Synonyms:- Benzenemethanol, α-methyl-4-(1H-pyrrol-1-yl)-
- α-Methyl-4-(1H-pyrrol-1-yl)benzenemethanol
- 1-[4-(1H-PYRROL-1-YL)PHENYL]-1-ETHANOL
- 1-[4-(1H-pyrrol-1-yl)phenyl]ethan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-[4-(1H-Pyrrol-1-yl)phenyl]ethan-1-ol
CAS:1-[4-(1H-Pyrrol-1-yl)phenyl]ethan-1-olPurity:techMolecular weight:187.24g/mol
