CAS 439134-78-8

5-(bromomethyl)-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole

Description:

5-(Bromomethyl)-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole is a heterocyclic organic compound characterized by its thiazole ring, which contains both sulfur and nitrogen atoms. The presence of a bromomethyl group indicates that it has a bromine atom attached to a carbon chain, enhancing its reactivity and potential for further chemical modifications. The compound also features a methyl group and a trifluoromethyl-substituted phenyl group, which contribute to its lipophilicity and influence its electronic properties. The trifluoromethyl group is known for imparting unique characteristics, such as increased metabolic stability and altered solubility. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural complexity and functional groups suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Overall, the combination of these features makes it a valuable compound for further study in various chemical and biological contexts.

Formula: C₁₂H₉BrF₃NS

InChI: InChI=1/C12H9BrF3NS/c1-7-10(6-13)18-11(17-7)8-2-4-9(5-3-8)12(14,15)16/h2-5H,6H2,1H3

SMILES: Cc1c(CBr)sc(c2ccc(cc2)C(F)(F)F)n1

Thiazole, 5-(bromomethyl)-4-methyl-2-[4-(trifluoromethyl)phenyl]-

CAS: 439134-78-8

Formula: C₁₂H₉BrF₃NS

Purity: 95%

Color and Shape: Solid

Molecular weight: 336.1708

Ref: IN-DA00I8DA

5-Bromomethyl-4-methyl-2-(4-trifluoromethyl-phenyl)-thiazole

CAS: 439134-78-8

5-Bromomethyl-4-methyl-2-(4-trifluoromethyl-phenyl)-thiazole

Purity: 95%

Molecular weight: 336.17g/mol

Ref: 54-PC446072

5-(Bromomethyl)-4-methyl-2-(4-(trifluoromethyl)phenyl)thiazole

CAS: 439134-78-8

Formula: C₁₂H₉BrF₃NS

Purity: 95.0%

Molecular weight: 336.17

Ref: 10-F226565