CAS 439147-95-2
:4-chloro-2,5,8-trimethylquinoline
Description:
4-Chloro-2,5,8-trimethylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features three methyl groups at the 2, 5, and 8 positions, along with a chlorine substituent at the 4 position, which influences its chemical reactivity and properties. Typically, quinolines exhibit aromatic characteristics, contributing to their stability and potential for various chemical reactions, such as electrophilic substitutions. The presence of the chlorine atom can enhance the compound's reactivity, making it useful in synthetic organic chemistry. Additionally, the methyl groups can affect the compound's solubility and polarity, impacting its behavior in different solvents. 4-Chloro-2,5,8-trimethylquinoline may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research into its biological activity and chemical behavior. Safety data and handling precautions should be considered due to the presence of chlorine and the potential for toxicity associated with certain quinoline derivatives.
Formula:C12H12ClN
InChI:InChI=1/C12H12ClN/c1-7-4-5-8(2)12-11(7)10(13)6-9(3)14-12/h4-6H,1-3H3
SMILES:Cc1ccc(C)c2c1c(cc(C)n2)Cl
Synonyms:- Quinoline, 4-Chloro-2,5,8-Trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.