CAS 4392-37-4
:N-(Aminoiminomethyl)benzenesulfonamide
Description:
N-(Aminoiminomethyl)benzenesulfonamide, also known by its CAS number 4392-37-4, is a chemical compound characterized by the presence of a sulfonamide group attached to a benzene ring, along with an aminoiminomethyl substituent. This compound typically exhibits properties associated with sulfonamides, such as solubility in polar solvents and potential biological activity. It may act as a weak acid due to the sulfonamide functional group, which can participate in hydrogen bonding. The amino group in the structure can also engage in various interactions, making it relevant in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's structure suggests potential applications in areas such as antimicrobial agents or enzyme inhibitors. Its stability and reactivity can be influenced by the surrounding functional groups, and it may undergo various chemical reactions typical of amines and sulfonamides. Overall, N-(Aminoiminomethyl)benzenesulfonamide is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C7H9N3O2S
InChI:InChI=1S/C7H9N3O2S/c8-7(9)10-13(11,12)6-4-2-1-3-5-6/h1-5H,(H4,8,9,10)
InChI key:InChIKey=BRSRNTJGTDYRFT-UHFFFAOYSA-N
SMILES:S(NC(=N)N)(=O)(=O)C1=CC=CC=C1
Synonyms:- 2-(Benzenesulfonyl)guanidine
- Benzenesulfonamide, N-(aminoiminomethyl)-
- Benzenesulfonamide, N-amidino-
- N-(Aminoiminomethyl)benzenesulfonamide
- N-(diaminomethylidene)benzenesulfonamide
- N-Benzenesulfonyl guanidine
- diamino-N-(phenylsulfonyl)methaniminium
- N-(Aminoiminomethyl)benzenesulphonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
