CAS 439215-15-3: N-(2-Phenylethyl)-2-benzothiazolamine

Description: N-(2-Phenylethyl)-2-benzothiazolamine is an organic compound characterized by its unique structure, which includes a benzothiazole moiety and a phenylethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential biological activity. The presence of the benzothiazole ring suggests that it may have applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. Its amine functional group can participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the compound may exhibit fluorescence properties due to its conjugated system, making it useful in certain analytical applications. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, N-(2-Phenylethyl)-2-benzothiazolamine represents a class of compounds that may have significant implications in medicinal chemistry and material science.

Formula: C₁₅H₁₄N₂S

InChI: InChI=1S/C15H14N2S/c1-2-6-12(7-3-1)10-11-16-15-17-13-8-4-5-9-14(13)18-15/h1-9H,10-11H2,(H,16,17)

InChI key: InChIKey=ZONFDQCCZSBEFC-UHFFFAOYSA-N

SMILES: N1=C(SC=2C=CC=CC12)NCCC=3C=CC=CC3

N-(2-Phenylethyl)-1,3-benzothiazol-2-amine

CAS: 439215-15-3

Versatile small molecule scaffold

• Formula: C₁₅H₁₄N₂S
• Purity: Min. 95%
• Molecular weight: 254.4 g/mol

N-(2-Phenylethyl)-1,3-benzothiazol-2-amine

CAS: 439215-15-3

• Purity: 95%
• Molecular weight: 254.35000610351562