CAS 4394-05-2
:2-[(2,3-Dimethylphenyl)amino]-3-pyridinecarboxylic acid
Description:
2-[(2,3-Dimethylphenyl)amino]-3-pyridinecarboxylic acid, with the CAS number 4394-05-2, is an organic compound characterized by its complex structure, which includes a pyridine ring and an amino group attached to a dimethyl-substituted phenyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents due to the presence of the carboxylic acid functional group. The presence of both the amino and carboxylic acid groups suggests that it can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the dimethyl substitution on the phenyl ring may affect its electronic properties and steric hindrance, potentially impacting its biological activity and applications in pharmaceuticals or agrochemicals. Overall, this compound's unique structural features contribute to its potential utility in various chemical and biological contexts.
Formula:C14H14N2O2
InChI:InChI=1S/C14H14N2O2/c1-9-5-3-7-12(10(9)2)16-13-11(14(17)18)6-4-8-15-13/h3-8H,1-2H3,(H,15,16)(H,17,18)
InChI key:InChIKey=XEQIPELDMSEBJG-UHFFFAOYSA-N
SMILES:N(C1=C(C(O)=O)C=CC=N1)C2=C(C)C(C)=CC=C2
Synonyms:- 2-(2,3-Dimethylanilino)pyridine-3-carboxylic acid
- 2-(2,3-Xylidino)nicotinic acid
- 2-[(2,3-Dimethylphenyl)Amino]Pyridine-3-Carboxylic Acid
- 2-[(2,3-Dimethylphenyl)amino]-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 2-[(2,3-dimethylphenyl)amino]-
- Acide nixylique [INN-French]
- Acido nixilico [INN-Spanish]
- Acidum nixylicum [INN-Latin]
- Nicotinic acid, 2-(2,3-xylidino)-
- Nixylic acid [INN:DCF]
- Unii-1Zi8H16Z5I
- Up 74
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-[(2,3-Dimethylphenyl)amino]nicotinic acid
CAS:2-[(2,3-Dimethylphenyl)amino]nicotinic acid is an arylpropionic acid that has been designed for the treatment of cancer. It is a neutral compound that can be crystallized or sterilized and then injected or implanted into tissues. The compound can be used as a diagnostic tool to target specific tissues in the body by using iontophoresis or organic solvents. 2-[(2,3-Dimethylphenyl)amino]nicotinic acid interacts with chlorine ions to form a chloride derivative, which is then transported through the tissue. This process can be reversed by adding an acid solution to the tissue, which will cause the chloride ions to break down into hydrogen and chloride ions.
Formula:C14H14N2O2Purity:Min. 95%Molecular weight:242.27 g/mol
