CymitQuimica logo

CAS 439687-92-0

:

2-(Methoxymethyl)pyrrolo[1,2-c]pyrimidin-1(2H)-one

Description:
2-(Methoxymethyl)pyrrolo[1,2-c]pyrimidin-1(2H)-one is a chemical compound characterized by its unique bicyclic structure, which incorporates a pyrrole and pyrimidine moiety. This compound features a methoxymethyl group, which enhances its solubility and reactivity. It typically exhibits properties such as moderate polarity due to the presence of the methoxy group, which can influence its interactions in biological systems. The compound may also display potential biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various functionalization possibilities, which can be explored for synthesizing derivatives with enhanced properties. Additionally, the presence of nitrogen atoms in the heterocyclic rings contributes to its potential as a ligand in coordination chemistry. Overall, 2-(Methoxymethyl)pyrrolo[1,2-c]pyrimidin-1(2H)-one is a versatile compound with applications in research and development, particularly in the fields of pharmaceuticals and organic synthesis.
Formula:C9H10N2O2
InChI:InChI=1S/C9H10N2O2/c1-13-7-10-6-4-8-3-2-5-11(8)9(10)12/h2-6H,7H2,1H3
InChI key:InChIKey=HCMNHKKIZIUMKO-UHFFFAOYSA-N
SMILES:O=C1N2C(C=CN1COC)=CC=C2
Synonyms:
  • Pyrrolo[1,2-c]pyrimidin-1(2H)-one, 2-(methoxymethyl)-
  • 2-(Methoxymethyl)pyrrolo[1,2-c]pyrimidin-1(2H)-one
  • 2-(Methoxymethyl)-1H,2H-pyrrolo[1,2-c]pyrimidin-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.